C15H16ClN3O2S — CID 82034683
3-amino-N-[3-chloro-4-[(2-thiophen-2-ylacetyl)amino]phenyl]propanamide (PubChem CID 82034683) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 3-amino-N-[3-chloro-4-[(2-thiophen-2-ylacetyl)amino]phenyl]propanamide.
| Compound Name | 3-amino-N-[3-chloro-4-[(2-thiophen-2-ylacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 82034683 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-amino-N-[3-chloro-4-[(2-thiophen-2-ylacetyl)amino]phenyl]propanamide |
| SMILES | NCCC(=O)Nc1ccc(NC(=O)Cc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClN3O2S/c16-12-8-10(18-14(20)5-6-17)3-4-13(12)19-15(21)9-11-2-1-7-22-11/h1-4,7-8H,5-6,9,17H2,(H,18,20)(H,19,21) |
| InChIKey | GAWBTXYLYNIRJA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |