C15H14ClNO3S — CID 88672143
N-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 88672143) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is N-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 88672143 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-[3-chloro-4-(oxiran-2-ylmethoxy)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(OCC2CO2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClNO3S/c16-13-6-10(3-4-14(13)20-9-11-8-19-11)17-15(18)7-12-2-1-5-21-12/h1-6,11H,7-9H2,(H,17,18) |
| InChIKey | KUHLNTCPDGPNNX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|