C18H23BrN2O3S — CID 70449999
N-[3-bromo-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 70449999) has the molecular formula C18H23BrN2O3S and a molecular weight of 427.36 g/mol. Its IUPAC name is N-[3-bromo-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-bromo-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 70449999 |
| Molecular Formula | C18H23BrN2O3S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[3-bromo-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)NCC(O)COc1ccc(NC(=O)Cc2cccs2)cc1Br |
| InChI | InChI=1S/C18H23BrN2O3S/c1-12(2)20-10-14(22)11-24-17-6-5-13(8-16(17)19)21-18(23)9-15-4-3-7-25-15/h3-8,12,14,20,22H,9-11H2,1-2H3,(H,21,23) |
| InChIKey | TXVUDVCXZDXLAT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |