C17H22BrNO3S — CID 112799340
1-[1-(3-bromo-4-methoxyphenyl)ethylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 112799340) has the molecular formula C17H22BrNO3S and a molecular weight of 400.34 g/mol. Its IUPAC name is 1-[1-(3-bromo-4-methoxyphenyl)ethylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[1-(3-bromo-4-methoxyphenyl)ethylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 112799340 |
| Molecular Formula | C17H22BrNO3S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 1-[1-(3-bromo-4-methoxyphenyl)ethylamino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | COc1ccc(C(C)NCC(O)COCc2cccs2)cc1Br |
| InChI | InChI=1S/C17H22BrNO3S/c1-12(13-5-6-17(21-2)16(18)8-13)19-9-14(20)10-22-11-15-4-3-7-23-15/h3-8,12,14,19-20H,9-11H2,1-2H3 |
| InChIKey | AAJGHTNRGXTAPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |