C14H22IN3O3 — CID 129396067
1-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-iodophenyl]-3-methylurea (PubChem CID 129396067) has the molecular formula C14H22IN3O3 and a molecular weight of 407.25 g/mol. Its IUPAC name is 1-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-iodophenyl]-3-methylurea.
| Compound Name | 1-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-iodophenyl]-3-methylurea |
|---|---|
| PubChem CID | 129396067 |
| Molecular Formula | C14H22IN3O3 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 1-[4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]-3-iodophenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(OC[C@@H](O)CNC(C)C)c(I)c1 |
| InChI | InChI=1S/C14H22IN3O3/c1-9(2)17-7-11(19)8-21-13-5-4-10(6-12(13)15)18-14(20)16-3/h4-6,9,11,17,19H,7-8H2,1-3H3,(H2,16,18,20)/t11-/m0/s1 |
| InChIKey | PXZUXTVSLKPNFG-NSHDSACASA-N |
| XLogP | 1.78 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|