C16H27N3O3 — CID 129396080
1-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-propylurea (PubChem CID 129396080) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-propylurea.
| Compound Name | 1-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-propylurea |
|---|---|
| PubChem CID | 129396080 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(OC[C@H](O)CNC(C)C)cc1 |
| InChI | InChI=1S/C16H27N3O3/c1-4-9-17-16(21)19-13-5-7-15(8-6-13)22-11-14(20)10-18-12(2)3/h5-8,12,14,18,20H,4,9-11H2,1-3H3,(H2,17,19,21)/t14-/m1/s1 |
| InChIKey | PDFJIOYMUYVQRK-CQSZACIVSA-N |
| XLogP | 1.96 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |