C25H36N2O4 — CID 13388918
4-hexoxy-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]benzamide (PubChem CID 13388918) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 4-hexoxy-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]benzamide.
| Compound Name | 4-hexoxy-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 13388918 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 4-hexoxy-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(OCC(O)CNC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H36N2O4/c1-4-5-6-7-16-30-23-12-8-20(9-13-23)25(29)27-21-10-14-24(15-11-21)31-18-22(28)17-26-19(2)3/h8-15,19,22,26,28H,4-7,16-18H2,1-3H3,(H,27,29) |
| InChIKey | ZNUAXNSCZUFCNX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|