About 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate
3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate (PubChem CID 19170770) has the molecular formula C25H33NO4
and a molecular weight of 411.54 g/mol. Its IUPAC name is 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate.
Molecular Properties
| Compound Name | 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate |
| PubChem CID | 19170770 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(C(=O)OCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-4-5-6-7-17-29-23-14-10-20(11-15-23)24(27)26-22-12-8-21(9-13-22)25(28)30-18-16-19(2)3/h8-15,19H,4-7,16-18H2,1-3H3,(H,26,27) |
| InChIKey | NMMZWHATGBDMFR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate?
The IUPAC name of 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate (CID 19170770) is 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate.
What is the SMILES notation for 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate?
The canonical SMILES for 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate is CCCCCCOc1ccc(C(=O)Nc2ccc(C(=O)OCCC(C)C)cc2)cc1.
What is the InChIKey of 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate?
The InChIKey is NMMZWHATGBDMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO4/c1-4-5-6-7-17-29-23-14-10-20(11-15-23)24(27)26-22-12-8-21(9-13-22)25(28)30-18-16-19(2)3/h8-15,19H,4-7,16-18H2,1-3H3,(H,26,27).
What are the key properties of 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate?
3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate has a molecular weight of 411.54 g/mol, XLogP of 6.10, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 4-[(4-hexoxybenzoyl)amino]benzoate is sourced from PubChem (CID 19170770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).