C16H23IN2O3 — CID 11015178
(E)-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-(123I)iodobut-3-enamide (PubChem CID 11015178) has the molecular formula C16H23IN2O3 and a molecular weight of 414.28 g/mol. Its IUPAC name is (E)-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-(123I)iodobut-3-enamide.
| Compound Name | (E)-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-(123I)iodobut-3-enamide |
|---|---|
| PubChem CID | 11015178 |
| Molecular Formula | C16H23IN2O3 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | (E)-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-(123I)iodobut-3-enamide |
| SMILES | CC(C)NCC(O)COc1ccc(NC(=O)C/C=C/[123I])cc1 |
| InChI | InChI=1S/C16H23IN2O3/c1-12(2)18-10-14(20)11-22-15-7-5-13(6-8-15)19-16(21)4-3-9-17/h3,5-9,12,14,18,20H,4,10-11H2,1-2H3,(H,19,21)/b9-3+/i17-4 |
| InChIKey | MOQLUPLBGJNFEG-JRXNUDMTSA-N |
| XLogP | 2.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|