C15H12ClN2O4S- — CID 6979012
4-[3-chloro-4-(thiophene-2-carbonylamino)anilino]-4-oxobutanoate (PubChem CID 6979012) has the molecular formula C15H12ClN2O4S- and a molecular weight of 351.79 g/mol. Its IUPAC name is 4-[3-chloro-4-(thiophene-2-carbonylamino)anilino]-4-oxobutanoate.
| Compound Name | 4-[3-chloro-4-(thiophene-2-carbonylamino)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 6979012 |
| Molecular Formula | C15H12ClN2O4S- |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-[3-chloro-4-(thiophene-2-carbonylamino)anilino]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)Nc1ccc(NC(=O)c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClN2O4S/c16-10-8-9(17-13(19)5-6-14(20)21)3-4-11(10)18-15(22)12-2-1-7-23-12/h1-4,7-8H,5-6H2,(H,17,19)(H,18,22)(H,20,21)/p-1 |
| InChIKey | BEXRNZGAGDXLGU-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |