C12H12Cl3NO2 — CID 10518914
[(2R,3S)-2-methyl-3-phenyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate (PubChem CID 10518914) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is [(2R,3S)-2-methyl-3-phenyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3S)-2-methyl-3-phenyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10518914 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | [(2R,3S)-2-methyl-3-phenyloxiran-2-yl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@@]1(C)O[C@H]1c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3NO2/c1-11(7-17-10(16)12(13,14)15)9(18-11)8-5-3-2-4-6-8/h2-6,9,16H,7H2,1H3/b16-10+/t9-,11+/m0/s1 |
| InChIKey | GZRPKABTFRUVTJ-UFFOAWRQSA-N |
| XLogP | 3.88 |
| TPSA | 45.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|