C14H11Cl6IN2O2 — CID 11071950
[(4S,5S,6R)-5-iodo-4-phenyl-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-6-yl]methyl 2,2,2-trichloroethanimidate (PubChem CID 11071950) has the molecular formula C14H11Cl6IN2O2 and a molecular weight of 578.88 g/mol. Its IUPAC name is [(4S,5S,6R)-5-iodo-4-phenyl-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-6-yl]methyl 2,2,2-trichloroethanimidate.
| Compound Name | [(4S,5S,6R)-5-iodo-4-phenyl-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-6-yl]methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11071950 |
| Molecular Formula | C14H11Cl6IN2O2 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 575.80 |
| IUPAC Name | [(4S,5S,6R)-5-iodo-4-phenyl-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-6-yl]methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@H]1OC(C(Cl)(Cl)Cl)=N[C@@H](c2ccccc2)[C@@H]1I)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H11Cl6IN2O2/c15-13(16,17)11(22)24-6-8-9(21)10(7-4-2-1-3-5-7)23-12(25-8)14(18,19)20/h1-5,8-10,22H,6H2/b22-11+/t8-,9-,10+/m1/s1 |
| InChIKey | GWADPTWFYKAXGE-XOUYWUDESA-N |
| XLogP | 6.06 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|