C14H14Cl3NO6 — CID 141046770
[(3R,4S,5R)-2-benzoyl-3,4,5-trihydroxyoxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 141046770) has the molecular formula C14H14Cl3NO6 and a molecular weight of 398.63 g/mol. Its IUPAC name is [(3R,4S,5R)-2-benzoyl-3,4,5-trihydroxyoxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5R)-2-benzoyl-3,4,5-trihydroxyoxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 141046770 |
| Molecular Formula | C14H14Cl3NO6 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | [(3R,4S,5R)-2-benzoyl-3,4,5-trihydroxyoxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1(C(=O)c2ccccc2)OC[C@@H](O)[C@H](O)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3NO6/c15-14(16,17)12(18)24-13(10(21)7-4-2-1-3-5-7)11(22)9(20)8(19)6-23-13/h1-5,8-9,11,18-20,22H,6H2/b18-12+/t8-,9+,11-,13?/m1/s1 |
| InChIKey | UAAYUZGKGLSQCZ-JIMDVJMBSA-N |
| XLogP | 1.04 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|