C18H18Cl6N2O7 — CID 87789097
[(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-(1-hydroxy-2-methoxy-2-phenylethenyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 87789097) has the molecular formula C18H18Cl6N2O7 and a molecular weight of 587.07 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-(1-hydroxy-2-methoxy-2-phenylethenyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-(1-hydroxy-2-methoxy-2-phenylethenyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 87789097 |
| Molecular Formula | C18H18Cl6N2O7 |
| Molecular Weight | 587.07 g/mol |
| Exact Mass | 583.92 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-4,5-dihydroxy-6-(1-hydroxy-2-methoxy-2-phenylethenyl)-3-[(2,2,2-trichloroacetyl)amino]oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C(O)=C(OC)c2ccccc2)[C@H](O)[C@H](O)[C@H]1NC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H18Cl6N2O7/c1-31-12(7-5-3-2-4-6-7)11(29)13-10(28)9(27)8(26-16(30)18(22,23)24)14(32-13)33-15(25)17(19,20)21/h2-6,8-10,13-14,25,27-29H,1H3,(H,26,30)/b12-11?,25-15+/t8-,9-,10-,13+,14-/m1/s1 |
| InChIKey | ZDWLBPRCLMDNRQ-PBKJTOBRSA-N |
| XLogP | 3.23 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.07 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|