C18H18O6 — CID 141123586
(3-phenylphenyl)-[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methanone (PubChem CID 141123586) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3-phenylphenyl)-[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methanone.
| Compound Name | (3-phenylphenyl)-[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 141123586 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3-phenylphenyl)-[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]methanone |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)[C@@]1(O)OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18O6/c19-14-10-24-18(23,17(22)15(14)20)16(21)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-9,14-15,17,19-20,22-23H,10H2/t14-,15-,17+,18+/m0/s1 |
| InChIKey | IIFIZSOXGWUJNX-CWLKWCNXSA-N |
| XLogP | 0.34 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |