C10H14Cl3NO7 — CID 69461362
[(2R,3R,4S,5S,6R)-2-acetyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 69461362) has the molecular formula C10H14Cl3NO7 and a molecular weight of 366.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-acetyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-acetyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 69461362 |
| Molecular Formula | C10H14Cl3NO7 |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-acetyl-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@]1(C(C)=O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO7/c1-3(16)9(21-8(14)10(11,12)13)7(19)6(18)5(17)4(2-15)20-9/h4-7,14-15,17-19H,2H2,1H3/b14-8+/t4-,5-,6+,7-,9+/m1/s1 |
| InChIKey | JYMSLYWSORJIFZ-KFGQAYDMSA-N |
| XLogP | -0.89 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|