C11H19NO7 — CID 67379981
(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxy-N-prop-2-enyloxane-2-carboxamide (PubChem CID 67379981) has the molecular formula C11H19NO7 and a molecular weight of 277.27 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxy-N-prop-2-enyloxane-2-carboxamide.
| Compound Name | (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxy-N-prop-2-enyloxane-2-carboxamide |
|---|---|
| PubChem CID | 67379981 |
| Molecular Formula | C11H19NO7 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxy-N-prop-2-enyloxane-2-carboxamide |
| SMILES | C=CCNC(=O)C1(OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO7/c1-3-4-12-10(17)11(18-2)9(16)8(15)7(14)6(5-13)19-11/h3,6-9,13-16H,1,4-5H2,2H3,(H,12,17)/t6-,7-,8+,9-,11?/m1/s1 |
| InChIKey | KQMOAKAMUQODKF-OGADHKOYSA-N |
| XLogP | -2.89 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|