C7H13NO7 — CID 141001854
N-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]formamide (PubChem CID 141001854) has the molecular formula C7H13NO7 and a molecular weight of 223.18 g/mol. Its IUPAC name is N-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]formamide.
| Compound Name | N-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]formamide |
|---|---|
| PubChem CID | 141001854 |
| Molecular Formula | C7H13NO7 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-[(2S,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]formamide |
| SMILES | O=CN[C@@]1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13NO7/c9-1-3-4(11)5(12)6(13)7(14,15-3)8-2-10/h2-6,9,11-14H,1H2,(H,8,10)/t3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | FSYMBWCNJXOZFH-ZFYZTMLRSA-N |
| XLogP | -4.15 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|