C8H14O7S — CID 141190126
1-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]ethanone (PubChem CID 141190126) has the molecular formula C8H14O7S and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]ethanone.
| Compound Name | 1-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]ethanone |
|---|---|
| PubChem CID | 141190126 |
| Molecular Formula | C8H14O7S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-[(3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@@H](O)[C@H](O)[C@@H](CO)OC1(O)S |
| InChI | InChI=1S/C8H14O7S/c1-3(10)7(13)6(12)5(11)4(2-9)15-8(7,14)16/h4-6,9,11-14,16H,2H2,1H3/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | HHPKRPIIGUTTKK-KEWYIRBNSA-N |
| XLogP | -3.00 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|