C8H16INO6 — CID 172553335
(3R,4S,5S,6R)-2-(dimethylamino)-6-(hydroxymethyl)-3-iodooxane-2,3,4,5-tetrol (PubChem CID 172553335) has the molecular formula C8H16INO6 and a molecular weight of 349.12 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(dimethylamino)-6-(hydroxymethyl)-3-iodooxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-2-(dimethylamino)-6-(hydroxymethyl)-3-iodooxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 172553335 |
| Molecular Formula | C8H16INO6 |
| Molecular Weight | 349.12 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | (3R,4S,5S,6R)-2-(dimethylamino)-6-(hydroxymethyl)-3-iodooxane-2,3,4,5-tetrol |
| SMILES | CN(C)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1(O)I |
| InChI | InChI=1S/C8H16INO6/c1-10(2)8(15)7(9,14)6(13)5(12)4(3-11)16-8/h4-6,11-15H,3H2,1-2H3/t4-,5-,6+,7+,8?/m1/s1 |
| InChIKey | YNTPMUIJVZLFSZ-WZPXOXCRSA-N |
| XLogP | -2.57 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.12 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|