C6H9NO5 — CID 164603128
(2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 164603128) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 164603128 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H9NO5/c7-2-6(11)5(10)4(9)3(1-8)12-6/h3-5,8-11H,1H2/t3-,4-,5+,6-/m1/s1 |
| InChIKey | UAMZEPHVXHRNKU-ARQDHWQXSA-N |
| XLogP | -2.69 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|