C7H10N4O5 — CID 100962429
(2S,3R,4S,5R,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carbonitrile (PubChem CID 100962429) has the molecular formula C7H10N4O5 and a molecular weight of 230.18 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carbonitrile.
| Compound Name | (2S,3R,4S,5R,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carbonitrile |
|---|---|
| PubChem CID | 100962429 |
| Molecular Formula | C7H10N4O5 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-azido-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carbonitrile |
| SMILES | N#C[C@]1(N=[N+]=[N-])O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H10N4O5/c8-2-7(10-11-9)6(15)5(14)4(13)3(1-12)16-7/h3-6,12-15H,1H2/t3-,4+,5+,6-,7+/m1/s1 |
| InChIKey | WQKGLDQIEBDLIC-PZRMXXKTSA-N |
| XLogP | -2.01 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|