C14H20O10 — CID 54299444
[(2S,3S,4S,5S,6R)-2,3-diacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 54299444) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-2,3-diacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5S,6R)-2,3-diacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 54299444 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-2,3-diacetyl-2-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C(C)=O)O[C@H](CO)[C@@H](O)[C@H](O)[C@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C14H20O10/c1-6(16)13(22-8(3)18)12(21)11(20)10(5-15)24-14(13,7(2)17)23-9(4)19/h10-12,15,20-21H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | SDDVCDGTCPUZFA-RGDJUOJXSA-N |
| XLogP | -2.16 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |