C13H18Cl3NO8 — CID 68962833
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-oxopentanoyl)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 68962833) has the molecular formula C13H18Cl3NO8 and a molecular weight of 422.65 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-oxopentanoyl)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-oxopentanoyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 68962833 |
| Molecular Formula | C13H18Cl3NO8 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-oxopentanoyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1(C(=O)CCC(C)=O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl3NO8/c1-5(19)2-3-7(20)12(25-11(17)13(14,15)16)10(23)9(22)8(21)6(4-18)24-12/h6,8-10,17-18,21-23H,2-4H2,1H3/b17-11+/t6-,8-,9+,10-,12?/m1/s1 |
| InChIKey | WHWOYVIZKMWKQI-GCDUYSPJSA-N |
| XLogP | -0.54 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|