C12H18O12 — CID 156963416
2-oxopropanoyl 2-hydroxy-2-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]propaneperoxoate (PubChem CID 156963416) has the molecular formula C12H18O12 and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-oxopropanoyl 2-hydroxy-2-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]propaneperoxoate.
| Compound Name | 2-oxopropanoyl 2-hydroxy-2-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]propaneperoxoate |
|---|---|
| PubChem CID | 156963416 |
| Molecular Formula | C12H18O12 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-oxopropanoyl 2-hydroxy-2-[2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]propaneperoxoate |
| SMILES | CC(=O)C(=O)OOC(=O)C(C)(O)C1(O)OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C12H18O12/c1-4(14)9(18)23-24-10(19)11(2,20)12(21)8(17)7(16)6(15)5(3-13)22-12/h5-8,13,15-17,20-21H,3H2,1-2H3 |
| InChIKey | KFQNTCARAVTGMW-UHFFFAOYSA-N |
| XLogP | -4.51 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|