C22H28Cl3NO7 — CID 11237791
[(Z)-3-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11237791) has the molecular formula C22H28Cl3NO7 and a molecular weight of 524.83 g/mol. Its IUPAC name is [(Z)-3-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z)-3-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11237791 |
| Molecular Formula | C22H28Cl3NO7 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | [(Z)-3-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C(/COCc1ccccc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H28Cl3NO7/c1-21(2)32-18-17(30-13-27-3)16(31-19(18)33-21)15(9-10-29-20(26)22(23,24)25)12-28-11-14-7-5-4-6-8-14/h4-9,16-19,26H,10-13H2,1-3H3/b15-9-,26-20+/t16-,17+,18-,19-/m1/s1 |
| InChIKey | HGUXIMXWSQNMRA-MZUOQOOJSA-N |
| XLogP | 4.36 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|