C20H24Cl3NO4 — CID 10939282
[(E,4S)-4-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 10939282) has the molecular formula C20H24Cl3NO4 and a molecular weight of 448.77 g/mol. Its IUPAC name is [(E,4S)-4-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10939282 |
| Molecular Formula | C20H24Cl3NO4 |
| Molecular Weight | 448.77 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | [(E,4S)-4-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxybut-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/[C@H](OCc1ccccc1)[C@H]1OC(C)(C)O[C@H]1C=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H24Cl3NO4/c1-4-15-17(28-19(2,3)27-15)16(26-13-14-9-6-5-7-10-14)11-8-12-25-18(24)20(21,22)23/h4-11,15-17,24H,1,12-13H2,2-3H3/b11-8+,24-18+/t15-,16-,17-/m0/s1 |
| InChIKey | YYADNVHTUMTNGT-QHQHAYIJSA-N |
| XLogP | 5.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|