C24H30O5 — CID 10763403
(2R)-2-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-phenylmethoxyprop-1-enyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol (PubChem CID 10763403) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-phenylmethoxyprop-1-enyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol.
| Compound Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-phenylmethoxyprop-1-enyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 10763403 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (2R)-2-[(4S,5S)-2,2-dimethyl-5-[(Z)-3-phenylmethoxyprop-1-enyl]-1,3-dioxolan-4-yl]-2-phenylmethoxyethanol |
| SMILES | CC1(C)O[C@H]([C@@H](CO)OCc2ccccc2)[C@H](/C=C\COCc2ccccc2)O1 |
| InChI | InChI=1S/C24H30O5/c1-24(2)28-21(14-9-15-26-17-19-10-5-3-6-11-19)23(29-24)22(16-25)27-18-20-12-7-4-8-13-20/h3-14,21-23,25H,15-18H2,1-2H3/b14-9-/t21-,22+,23-/m0/s1 |
| InChIKey | AYQVUZZYOGAOLX-PPFYPNLKSA-N |
| XLogP | 3.86 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|