C26H32O6 — CID 10972223
(3aR,5R,6S,6aR)-5-[(Z)-1,4-bis(phenylmethoxy)but-2-en-2-yl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 10972223) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(Z)-1,4-bis(phenylmethoxy)but-2-en-2-yl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(Z)-1,4-bis(phenylmethoxy)but-2-en-2-yl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 10972223 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(Z)-1,4-bis(phenylmethoxy)but-2-en-2-yl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1/C(=C\COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-26(2)31-24-23(27-3)22(30-25(24)32-26)21(18-29-17-20-12-8-5-9-13-20)14-15-28-16-19-10-6-4-7-11-19/h4-14,22-25H,15-18H2,1-3H3/b21-14-/t22-,23+,24-,25-/m1/s1 |
| InChIKey | PVAHOOVKCAWBHM-UKROAKAPSA-N |
| XLogP | 4.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|