About carbamimidoyl N-benzylcarbamate
carbamimidoyl N-benzylcarbamate (PubChem CID 68502456) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is carbamimidoyl N-benzylcarbamate.
Molecular Properties
| Compound Name | carbamimidoyl N-benzylcarbamate |
| PubChem CID | 68502456 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | carbamimidoyl N-benzylcarbamate |
| SMILES | [H]/N=C(\N)OC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C9H11N3O2/c10-8(11)14-9(13)12-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11)(H,12,13) |
| InChIKey | XWJNFHFCOAVKGT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl N-benzylcarbamate?
The IUPAC name of carbamimidoyl N-benzylcarbamate (CID 68502456) is carbamimidoyl N-benzylcarbamate.
What is the SMILES notation for carbamimidoyl N-benzylcarbamate?
The canonical SMILES for carbamimidoyl N-benzylcarbamate is [H]/N=C(\N)OC(=O)NCc1ccccc1.
What is the InChIKey of carbamimidoyl N-benzylcarbamate?
The InChIKey is XWJNFHFCOAVKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c10-8(11)14-9(13)12-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11)(H,12,13).
What are the key properties of carbamimidoyl N-benzylcarbamate?
carbamimidoyl N-benzylcarbamate has a molecular weight of 193.21 g/mol, XLogP of 0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl N-benzylcarbamate is sourced from PubChem (CID 68502456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).