C19H22N2O3 — CID 95220454
(2R,6R)-2-methyl-6-phenyl-N-phenylmethoxymorpholine-4-carboxamide (PubChem CID 95220454) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2R,6R)-2-methyl-6-phenyl-N-phenylmethoxymorpholine-4-carboxamide.
| Compound Name | (2R,6R)-2-methyl-6-phenyl-N-phenylmethoxymorpholine-4-carboxamide |
|---|---|
| PubChem CID | 95220454 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2R,6R)-2-methyl-6-phenyl-N-phenylmethoxymorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NOCc2ccccc2)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H22N2O3/c1-15-12-21(13-18(24-15)17-10-6-3-7-11-17)19(22)20-23-14-16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3,(H,20,22)/t15-,18+/m1/s1 |
| InChIKey | CKSAIOMHANDKEF-QAPCUYQASA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|