C25H30N2O4 — CID 60587008
benzyl 4-(2-methyl-6-phenylmorpholine-4-carbonyl)piperidine-1-carboxylate (PubChem CID 60587008) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is benzyl 4-(2-methyl-6-phenylmorpholine-4-carbonyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(2-methyl-6-phenylmorpholine-4-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60587008 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | benzyl 4-(2-methyl-6-phenylmorpholine-4-carbonyl)piperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)C2CCN(C(=O)OCc3ccccc3)CC2)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C25H30N2O4/c1-19-16-27(17-23(31-19)21-10-6-3-7-11-21)24(28)22-12-14-26(15-13-22)25(29)30-18-20-8-4-2-5-9-20/h2-11,19,22-23H,12-18H2,1H3 |
| InChIKey | RIPGTDJPUFDJTA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |