C13H14N2O2 — CID 151767444
2-phenylmethoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 151767444) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-phenylmethoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | 2-phenylmethoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 151767444 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-phenylmethoxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | O=C1NC2C=CC(OCc3ccccc3)N1C2 |
| InChI | InChI=1S/C13H14N2O2/c16-13-14-11-6-7-12(15(13)8-11)17-9-10-4-2-1-3-5-10/h1-7,11-12H,8-9H2,(H,14,16) |
| InChIKey | RRWLZQSEZVIRQE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|