C15H19N3O3 — CID 138572239
(4aS,7R)-7-(phenylmethoxyamino)-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 138572239) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (4aS,7R)-7-(phenylmethoxyamino)-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | (4aS,7R)-7-(phenylmethoxyamino)-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 138572239 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (4aS,7R)-7-(phenylmethoxyamino)-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | O=C1C[C@@H]2CC[C@@H](NOCc3ccccc3)CN2C(=O)N1 |
| InChI | InChI=1S/C15H19N3O3/c19-14-8-13-7-6-12(9-18(13)15(20)16-14)17-21-10-11-4-2-1-3-5-11/h1-5,12-13,17H,6-10H2,(H,16,19,20)/t12-,13+/m1/s1 |
| InChIKey | YWDOLAUBBLKLQG-OLZOCXBDSA-N |
| XLogP | 1.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|