C14H21IN2O3 — CID 166868059
2-[(2S,5R)-1-iodo-5-(phenylmethoxyamino)piperidin-2-yl]ethane-1,1-diol (PubChem CID 166868059) has the molecular formula C14H21IN2O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-[(2S,5R)-1-iodo-5-(phenylmethoxyamino)piperidin-2-yl]ethane-1,1-diol.
| Compound Name | 2-[(2S,5R)-1-iodo-5-(phenylmethoxyamino)piperidin-2-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 166868059 |
| Molecular Formula | C14H21IN2O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-[(2S,5R)-1-iodo-5-(phenylmethoxyamino)piperidin-2-yl]ethane-1,1-diol |
| SMILES | OC(O)C[C@@H]1CC[C@@H](NOCc2ccccc2)CN1I |
| InChI | InChI=1S/C14H21IN2O3/c15-17-9-12(6-7-13(17)8-14(18)19)16-20-10-11-4-2-1-3-5-11/h1-5,12-14,16,18-19H,6-10H2/t12-,13+/m1/s1 |
| InChIKey | WQTKLFZIJMTOFR-OLZOCXBDSA-N |
| XLogP | 1.59 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|