C17H26N2O4 — CID 144936982
ethane;methyl formate;6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 144936982) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is ethane;methyl formate;6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | ethane;methyl formate;6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 144936982 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethane;methyl formate;6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | CC.COC=O.O=C1N2CCCC(C2)N1OCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2.C2H4O2.C2H6/c16-13-14-8-4-7-12(9-14)15(13)17-10-11-5-2-1-3-6-11;1-4-2-3;1-2/h1-3,5-6,12H,4,7-10H2;2H,1H3;1-2H3 |
| InChIKey | UUKDQKGCUJMBJV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|