C16H18N4O4 — CID 142470615
methyl formate;10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-9-one (PubChem CID 142470615) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl formate;10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-9-one.
| Compound Name | methyl formate;10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-9-one |
|---|---|
| PubChem CID | 142470615 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl formate;10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-9-one |
| SMILES | COC=O.O=C1N2Cc3[nH]ncc3C(C2)N1OCc1ccccc1 |
| InChI | InChI=1S/C14H14N4O2.C2H4O2/c19-14-17-7-12-11(6-15-16-12)13(8-17)18(14)20-9-10-4-2-1-3-5-10;1-4-2-3/h1-6,13H,7-9H2,(H,15,16);2H,1H3 |
| InChIKey | LSXFAMYNQQDLEM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|