C14H15N5O2 — CID 69345757
3-methyl-10-phenylmethoxy-3,4,5,8,10-pentazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one (PubChem CID 69345757) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-methyl-10-phenylmethoxy-3,4,5,8,10-pentazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one.
| Compound Name | 3-methyl-10-phenylmethoxy-3,4,5,8,10-pentazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one |
|---|---|
| PubChem CID | 69345757 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-methyl-10-phenylmethoxy-3,4,5,8,10-pentazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-9-one |
| SMILES | Cn1nnc2c1C1CN(C2)C(=O)N1OCc1ccccc1 |
| InChI | InChI=1S/C14H15N5O2/c1-17-13-11(15-16-17)7-18-8-12(13)19(14(18)20)21-9-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3 |
| InChIKey | YYXZCXKGBVQHNW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |