C14H12N4O2 — CID 142675510
10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,4,6-trien-9-one (PubChem CID 142675510) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,4,6-trien-9-one.
| Compound Name | 10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 142675510 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,4,6-trien-9-one |
| SMILES | O=C1N2C=C3N=NC=C3C(C2)N1OCc1ccccc1 |
| InChI | InChI=1S/C14H12N4O2/c19-14-17-7-12-11(6-15-16-12)13(8-17)18(14)20-9-10-4-2-1-3-5-10/h1-7,13H,8-9H2 |
| InChIKey | KONQFRYNSQMTKR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |