C16H19ClN4O6S2 — CID 162464744
N-[2-(hydroxymethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-yl]-2-nitro-N-prop-2-enoxybenzenesulfonamide;hydrochloride (PubChem CID 162464744) has the molecular formula C16H19ClN4O6S2 and a molecular weight of 462.94 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-yl]-2-nitro-N-prop-2-enoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(hydroxymethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-yl]-2-nitro-N-prop-2-enoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 162464744 |
| Molecular Formula | C16H19ClN4O6S2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | N-[2-(hydroxymethyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-7-yl]-2-nitro-N-prop-2-enoxybenzenesulfonamide;hydrochloride |
| SMILES | C=CCON(C1CNCc2nc(CO)sc21)S(=O)(=O)c1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H18N4O6S2.ClH/c1-2-7-26-20(13-9-17-8-11-16(13)27-15(10-21)18-11)28(24,25)14-6-4-3-5-12(14)19(22)23;/h2-6,13,17,21H,1,7-10H2;1H |
| InChIKey | ISTWPSOMOOAYIH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|