C21H22N4O8S — CID 141382031
N-[6-(hydroxymethyl)-4-(2-nitroethyl)-2,3-dihydropyridin-3-yl]-2-nitro-N-phenylmethoxybenzenesulfonamide (PubChem CID 141382031) has the molecular formula C21H22N4O8S and a molecular weight of 490.49 g/mol. Its IUPAC name is N-[6-(hydroxymethyl)-4-(2-nitroethyl)-2,3-dihydropyridin-3-yl]-2-nitro-N-phenylmethoxybenzenesulfonamide.
| Compound Name | N-[6-(hydroxymethyl)-4-(2-nitroethyl)-2,3-dihydropyridin-3-yl]-2-nitro-N-phenylmethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141382031 |
| Molecular Formula | C21H22N4O8S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[6-(hydroxymethyl)-4-(2-nitroethyl)-2,3-dihydropyridin-3-yl]-2-nitro-N-phenylmethoxybenzenesulfonamide |
| SMILES | O=[N+]([O-])CCC1=CC(CO)=NCC1N(OCc1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N4O8S/c26-14-18-12-17(10-11-23(27)28)20(13-22-18)25(33-15-16-6-2-1-3-7-16)34(31,32)21-9-5-4-8-19(21)24(29)30/h1-9,12,20,26H,10-11,13-15H2 |
| InChIKey | FORIMMWMIXNZPX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|