C16H18N4O7S — CID 174837157
6-methoxy-3-[(2-nitrophenyl)sulfonyl-prop-2-enoxyamino]-2,3-dihydropyridine-4-carboxamide (PubChem CID 174837157) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is 6-methoxy-3-[(2-nitrophenyl)sulfonyl-prop-2-enoxyamino]-2,3-dihydropyridine-4-carboxamide.
| Compound Name | 6-methoxy-3-[(2-nitrophenyl)sulfonyl-prop-2-enoxyamino]-2,3-dihydropyridine-4-carboxamide |
|---|---|
| PubChem CID | 174837157 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 6-methoxy-3-[(2-nitrophenyl)sulfonyl-prop-2-enoxyamino]-2,3-dihydropyridine-4-carboxamide |
| SMILES | C=CCON(C1CN=C(OC)C=C1C(N)=O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O7S/c1-3-8-27-20(13-10-18-15(26-2)9-11(13)16(17)21)28(24,25)14-7-5-4-6-12(14)19(22)23/h3-7,9,13H,1,8,10H2,2H3,(H2,17,21) |
| InChIKey | FQQWHZCIZKWJSV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|