C28H31N3O6S — CID 156766567
(3S,4S,5R)-N-benzyl-4-[(4-methoxyphenyl)methoxy]-1-(2-nitrophenyl)sulfonyl-5-prop-2-enylpyrrolidin-3-amine (PubChem CID 156766567) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is (3S,4S,5R)-N-benzyl-4-[(4-methoxyphenyl)methoxy]-1-(2-nitrophenyl)sulfonyl-5-prop-2-enylpyrrolidin-3-amine.
| Compound Name | (3S,4S,5R)-N-benzyl-4-[(4-methoxyphenyl)methoxy]-1-(2-nitrophenyl)sulfonyl-5-prop-2-enylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 156766567 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (3S,4S,5R)-N-benzyl-4-[(4-methoxyphenyl)methoxy]-1-(2-nitrophenyl)sulfonyl-5-prop-2-enylpyrrolidin-3-amine |
| SMILES | C=CC[C@@H]1[C@@H](OCc2ccc(OC)cc2)[C@@H](NCc2ccccc2)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H31N3O6S/c1-3-9-26-28(37-20-22-14-16-23(36-2)17-15-22)24(29-18-21-10-5-4-6-11-21)19-30(26)38(34,35)27-13-8-7-12-25(27)31(32)33/h3-8,10-17,24,26,28-29H,1,9,18-20H2,2H3/t24-,26+,28-/m0/s1 |
| InChIKey | OHTRWDQNGNUAAN-YIOBJHAYSA-N |
| XLogP | 4.30 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|