C21H27Cl3N2O7 — CID 140877977
1-O-tert-butyl 2-O-methyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate (PubChem CID 140877977) has the molecular formula C21H27Cl3N2O7 and a molecular weight of 525.81 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140877977 |
| Molecular Formula | C21H27Cl3N2O7 |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27Cl3N2O7/c1-20(2,3)32-18(28)25-12-15(10-11-16(25)17(27)30-4)26(19(29)33-21(22,23)24)31-13-14-8-6-5-7-9-14/h5-9,15-16H,10-13H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | CWHRHBAMPRCZMN-CVEARBPZSA-N |
| XLogP | 4.83 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|