C27H30Cl3N3O8 — CID 122436934
(2S,5R)-2-(4-carbamoylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid (PubChem CID 122436934) has the molecular formula C27H30Cl3N3O8 and a molecular weight of 630.91 g/mol. Its IUPAC name is (2S,5R)-2-(4-carbamoylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-2-(4-carbamoylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122436934 |
| Molecular Formula | C27H30Cl3N3O8 |
| Molecular Weight | 630.91 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | (2S,5R)-2-(4-carbamoylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CC[C@@]1(C(=O)O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C27H30Cl3N3O8/c1-25(2,3)40-23(37)32-15-20(13-14-26(32,22(35)36)19-11-9-18(10-12-19)21(31)34)33(24(38)41-27(28,29)30)39-16-17-7-5-4-6-8-17/h4-12,20H,13-16H2,1-3H3,(H2,31,34)(H,35,36)/t20-,26+/m1/s1 |
| InChIKey | SUQCKBRLNJJNMM-IBVKSMDESA-N |
| XLogP | 5.36 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|