C23H28Cl3N3O6S2 — CID 140738321
tert-butyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]-2-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidine-1-carboxylate (PubChem CID 140738321) has the molecular formula C23H28Cl3N3O6S2 and a molecular weight of 612.99 g/mol. Its IUPAC name is tert-butyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]-2-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]-2-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140738321 |
| Molecular Formula | C23H28Cl3N3O6S2 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | tert-butyl (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]-2-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CC[C@H]1C(=O)N1CCSC1=S |
| InChI | InChI=1S/C23H28Cl3N3O6S2/c1-22(2,3)34-19(31)28-13-16(9-10-17(28)18(30)27-11-12-37-21(27)36)29(20(32)35-23(24,25)26)33-14-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | XNYBZXWYAHMWIU-SJORKVTESA-N |
| XLogP | 5.51 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|