C18H20Cl3N3O4S2 — CID 122436935
trichloromethyl N-phenylmethoxy-N-[(3R,6S)-6-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidin-3-yl]carbamate (PubChem CID 122436935) has the molecular formula C18H20Cl3N3O4S2 and a molecular weight of 512.87 g/mol. Its IUPAC name is trichloromethyl N-phenylmethoxy-N-[(3R,6S)-6-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidin-3-yl]carbamate.
| Compound Name | trichloromethyl N-phenylmethoxy-N-[(3R,6S)-6-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 122436935 |
| Molecular Formula | C18H20Cl3N3O4S2 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | trichloromethyl N-phenylmethoxy-N-[(3R,6S)-6-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)piperidin-3-yl]carbamate |
| SMILES | O=C([C@@H]1CC[C@@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CN1)N1CCSC1=S |
| InChI | InChI=1S/C18H20Cl3N3O4S2/c19-18(20,21)28-16(26)24(27-11-12-4-2-1-3-5-12)13-6-7-14(22-10-13)15(25)23-8-9-30-17(23)29/h1-5,13-14,22H,6-11H2/t13-,14+/m1/s1 |
| InChIKey | XNYLGBFDODZLTO-KGLIPLIRSA-N |
| XLogP | 3.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|