C18H23NO4S2 — CID 139685184
[(2R)-3-oxo-7-phenylmethoxyheptan-2-yl] 2-sulfanylidene-1,3-thiazolidine-3-carboxylate (PubChem CID 139685184) has the molecular formula C18H23NO4S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is [(2R)-3-oxo-7-phenylmethoxyheptan-2-yl] 2-sulfanylidene-1,3-thiazolidine-3-carboxylate.
| Compound Name | [(2R)-3-oxo-7-phenylmethoxyheptan-2-yl] 2-sulfanylidene-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 139685184 |
| Molecular Formula | C18H23NO4S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [(2R)-3-oxo-7-phenylmethoxyheptan-2-yl] 2-sulfanylidene-1,3-thiazolidine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)N1CCSC1=S)C(=O)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C18H23NO4S2/c1-14(23-17(21)19-10-12-25-18(19)24)16(20)9-5-6-11-22-13-15-7-3-2-4-8-15/h2-4,7-8,14H,5-6,9-13H2,1H3/t14-/m1/s1 |
| InChIKey | LUCVFNSMXSQHRL-CQSZACIVSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|