C12H13NO2S2 — CID 13289317
2-phenylmethoxy-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone (PubChem CID 13289317) has the molecular formula C12H13NO2S2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-phenylmethoxy-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 2-phenylmethoxy-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 13289317 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-phenylmethoxy-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)ethanone |
| SMILES | O=C(COCc1ccccc1)N1CCSC1=S |
| InChI | InChI=1S/C12H13NO2S2/c14-11(13-6-7-17-12(13)16)9-15-8-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | IXLHEGXRGRQHET-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|