C26H28Cl4N2O7 — CID 140877973
1-O-tert-butyl 2-O-(4-chlorophenyl) (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate (PubChem CID 140877973) has the molecular formula C26H28Cl4N2O7 and a molecular weight of 622.33 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(4-chlorophenyl) (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(4-chlorophenyl) (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140877973 |
| Molecular Formula | C26H28Cl4N2O7 |
| Molecular Weight | 622.33 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | 1-O-tert-butyl 2-O-(4-chlorophenyl) (2S,5R)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CC[C@H]1C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28Cl4N2O7/c1-25(2,3)38-23(34)31-15-19(11-14-21(31)22(33)37-20-12-9-18(27)10-13-20)32(24(35)39-26(28,29)30)36-16-17-7-5-4-6-8-17/h4-10,12-13,19,21H,11,14-16H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | ANRWLCBNHCELGD-CTNGQTDRSA-N |
| XLogP | 6.91 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.33 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|